2-phenyl-1,3-thiazole-4,5-dicarboxamide structure
|
Common Name | 2-phenyl-1,3-thiazole-4,5-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 7403-85-2 | Molecular Weight | 247.27300 | |
| Density | 1.414g/cm3 | Boiling Point | 570.2ºC at 760 mmHg | |
| Molecular Formula | C11H9N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 298.7ºC | |
| Name | 2-phenyl-1,3-thiazole-4,5-dicarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.414g/cm3 |
|---|---|
| Boiling Point | 570.2ºC at 760 mmHg |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.27300 |
| Flash Point | 298.7ºC |
| Exact Mass | 247.04200 |
| PSA | 127.31000 |
| LogP | 2.40850 |
| Index of Refraction | 1.668 |
| InChIKey | MCDDGOXYHULKSQ-UHFFFAOYSA-N |
| SMILES | NC(=O)c1nc(-c2ccccc2)sc1C(N)=O |
|
~%
2-phenyl-1,3-th... CAS#:7403-85-2 |
| Literature: Childress; McKee Journal of the American Chemical Society, 1951 , vol. 73, p. 3862 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Phenyl-thiazol-4,5-dicarbonsaeure-diamid |
| 2-Phenyl-4,5-dicarboxamidothiazol |
| 2-phenyl-thiazole-4,5-dicarboxylic acid diamide |