[1-(oxan-4-yl)heptylideneamino]urea structure
|
Common Name | [1-(oxan-4-yl)heptylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 7403-99-8 | Molecular Weight | 255.35600 | |
| Density | 1.148g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(E)-1-(oxan-4-yl)heptylideneamino]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.35600 |
| Exact Mass | 255.19500 |
| PSA | 76.71000 |
| LogP | 3.49890 |
| Index of Refraction | 1.542 |
| InChIKey | NERRYOQMUJCUHZ-QINSGFPZSA-N |
| SMILES | CCCCCCC(=NNC(N)=O)C1CCOCC1 |
|
~%
[1-(oxan-4-yl)h... CAS#:7403-99-8 |
| Literature: Henze; McKee Journal of the American Chemical Society, 1942 , vol. 64, p. 1672 |
|
~%
[1-(oxan-4-yl)h... CAS#:7403-99-8 |
| Literature: Henze; McKee Journal of the American Chemical Society, 1942 , vol. 64, p. 1672 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-tetrahydropyran-4-yl-heptan-1-one semicarbazone |
| 1-Tetrahydropyran-4-yl-heptan-1-on-semicarbazon |