1,3-Dimethyl-8-(cyclohexylmethyl)xanthine structure
|
Common Name | 1,3-Dimethyl-8-(cyclohexylmethyl)xanthine | ||
|---|---|---|---|---|
| CAS Number | 74039-70-6 | Molecular Weight | 276.33400 | |
| Density | 1.266g/cm3 | Boiling Point | 517.3ºC at 760 mmHg | |
| Molecular Formula | C14H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.6ºC | |
| Name | 8-(cyclohexylmethyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 517.3ºC at 760 mmHg |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.33400 |
| Flash Point | 266.6ºC |
| Exact Mass | 276.15900 |
| PSA | 72.68000 |
| LogP | 1.08310 |
| Index of Refraction | 1.59 |
| InChIKey | ZCUVAPMRCRWXEP-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c(CC3CCCCC3)nc2n(C)c1=O |
|
~%
1,3-Dimethyl-8-... CAS#:74039-70-6 |
| Literature: Hager et al. Journal of the American Pharmaceutical Association (1912-1977), 1954 , vol. 43, p. 152,154 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-cyclohexylmethyl-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |
| 8-Cyclohexylmethyl-1,3-dimethyl-3,7-dihydro-purin-2,6-dion |