dibromo-(3-nitrophenyl)arsane
dibromo-(3-nitrophenyl)arsane structure
|
Common Name | dibromo-(3-nitrophenyl)arsane | ||
|---|---|---|---|---|
| CAS Number | 7404-64-0 | Molecular Weight | 356.83100 | |
| Density | N/A | Boiling Point | 346.2ºC at 760 mmHg | |
| Molecular Formula | C6H4AsBr2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dibromo-(3-nitrophenyl)arsane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 346.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H4AsBr2NO2 |
| Molecular Weight | 356.83100 |
| Flash Point | 163.2ºC |
| Exact Mass | 354.78200 |
| PSA | 45.82000 |
| LogP | 2.60300 |
| InChIKey | PWSSBRRMSIOJOH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc([As](Br)Br)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
dibromo-(3-nitr... CAS#:7404-64-0 |
| Literature: Blicke; Powers Journal of the American Chemical Society, 1932 , vol. 54, p. 2945 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dibrom-(3-nitro-phenyl)-arsin |
| As.As-Dibrom-3-nitro-phenylarsin |
| (3-Nitro-phenyl)-arsendibromid |
| dibromo-(3-nitro-phenyl)-arsine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of dibromo-(3-nitrophenyl)arsane? |
| A: The English name of dibromo-(3-nitrophenyl)arsane is dibromo-(3-nitrophenyl)arsane. |
| Q: What is the CAS number of dibromo-(3-nitrophenyl)arsane? |
| A: CAS number of dibromo-(3-nitrophenyl)arsane is 7404-64-0. |
| Q: What is the Chinese name of 7404-64-0? |
| A: Chinese name of 7404-64-0 is 7404-64-0. |
| Q: What is the molecular weight of dibromo-(3-nitrophenyl)arsane? |
| A: Molecular weight of dibromo-(3-nitrophenyl)arsane is 356.83100. |
| Q: What is the polar surface area (PSA) of dibromo-(3-nitrophenyl)arsane? |
| A: Polar surface area (PSA) of dibromo-(3-nitrophenyl)arsane is 45.82000. |
| Q: What is the boiling point of dibromo-(3-nitrophenyl)arsane? |
| A: Boiling point of dibromo-(3-nitrophenyl)arsane is 346.2ºC at 760 mmHg. |
| Q: What are the upstream materials of dibromo-(3-nitrophenyl)arsane? |
| A: Related upstream materials(CAS) of dibromo-(3-nitrophenyl)arsane: 6333-94-4. |
| Q: What is the LogP of dibromo-(3-nitrophenyl)arsane? |
| A: LogP of dibromo-(3-nitrophenyl)arsane is 2.60300. |
| Q: What English synonyms does dibromo-(3-nitrophenyl)arsane have? |
| A: English synonyms of dibromo-(3-nitrophenyl)arsane: Dibrom-(3-nitro-phenyl)-arsin, As.As-Dibrom-3-nitro-phenylarsin, (3-Nitro-phenyl)-arsendibromid, dibromo-(3-nitro-phenyl)-arsine. |
| Q: What is the molecular formula of dibromo-(3-nitrophenyl)arsane? |
| A: Molecular formula of dibromo-(3-nitrophenyl)arsane is C6H4AsBr2NO2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |