dibromo-(3-nitrophenyl)arsane structure
|
Common Name | dibromo-(3-nitrophenyl)arsane | ||
|---|---|---|---|---|
| CAS Number | 7404-64-0 | Molecular Weight | 356.83100 | |
| Density | N/A | Boiling Point | 346.2ºC at 760 mmHg | |
| Molecular Formula | C6H4AsBr2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.2ºC | |
| Name | dibromo-(3-nitrophenyl)arsane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 346.2ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H4AsBr2NO2 |
| Molecular Weight | 356.83100 |
| Flash Point | 163.2ºC |
| Exact Mass | 354.78200 |
| PSA | 45.82000 |
| LogP | 2.60300 |
| InChIKey | PWSSBRRMSIOJOH-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc([As](Br)Br)c1 |
|
~%
dibromo-(3-nitr... CAS#:7404-64-0 |
| Literature: Blicke; Powers Journal of the American Chemical Society, 1932 , vol. 54, p. 2945 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Dibrom-(3-nitro-phenyl)-arsin |
| As.As-Dibrom-3-nitro-phenylarsin |
| (3-Nitro-phenyl)-arsendibromid |
| dibromo-(3-nitro-phenyl)-arsine |