1-(2-hydroxy-2-methyl-5-nitro-5-propyl-cyclohexyl)ethanone
1-(2-hydroxy-2-methyl-5-nitro-5-propyl-cyclohexyl)ethanone structure
|
Common Name | 1-(2-hydroxy-2-methyl-5-nitro-5-propyl-cyclohexyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 7404-75-3 | Molecular Weight | 243.29900 | |
| Density | 1.12g/cm3 | Boiling Point | 365.6ºC at 760 mmHg | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 365.6ºC at 760 mmHg |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.29900 |
| Flash Point | 149.9ºC |
| Exact Mass | 243.14700 |
| PSA | 83.12000 |
| LogP | 2.46530 |
| Index of Refraction | 1.496 |
| InChIKey | LHIKMPKGTVKURF-UHFFFAOYSA-N |
| SMILES | CCCC1([N+](=O)[O-])CCC(C)(O)C(C(C)=O)C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
1-(2-hydroxy-2-... CAS#:7404-75-3 |
| Literature: Ballini, Roberto; Barboni, Luciano; Bosica, Giovanna Journal of Organic Chemistry, 2000 , vol. 65, # 19 p. 6261 - 6263 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Methyl-2-acetyl-4-propyl-4-nitro-cyclohexanol-(1) |
| (+/-)-1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)-1-ethanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone? |
| A: LogP of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone is 2.46530. |
| Q: What is the CAS number of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone? |
| A: CAS number of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone is 7404-75-3. |
| Q: What is the InChIKey of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone? |
| A: InChIKey of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone is LHIKMPKGTVKURF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone? |
| A: Molecular weight of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone is 243.29900. |
| Q: What is the boiling point of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone? |
| A: Boiling point of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone is 365.6ºC at 760 mmHg. |
| Q: What English synonyms does 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone have? |
| A: English synonyms of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone: 1-Methyl-2-acetyl-4-propyl-4-nitro-cyclohexanol-(1), (+/-)-1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)-1-ethanone. |
| Q: What is the English name of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone? |
| A: The English name of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone is 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone. |
| Q: What are the upstream materials of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone? |
| A: Related upstream materials(CAS) of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone: 627-05-4;78-94-4. |
| Q: What is the Chinese name of 7404-75-3? |
| A: Chinese name of 7404-75-3 is 7404-75-3. |
| Q: What is the SMILES notation of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone? |
| A: SMILES notation of 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone is CCCC1([N+](=O)[O-])CCC(C)(O)C(C(C)=O)C1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |