1-(2-hydroxy-2-methyl-5-nitro-5-propyl-cyclohexyl)ethanone structure
|
Common Name | 1-(2-hydroxy-2-methyl-5-nitro-5-propyl-cyclohexyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 7404-75-3 | Molecular Weight | 243.29900 | |
| Density | 1.12g/cm3 | Boiling Point | 365.6ºC at 760 mmHg | |
| Molecular Formula | C12H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9ºC | |
| Name | 1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 365.6ºC at 760 mmHg |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.29900 |
| Flash Point | 149.9ºC |
| Exact Mass | 243.14700 |
| PSA | 83.12000 |
| LogP | 2.46530 |
| Index of Refraction | 1.496 |
| InChIKey | LHIKMPKGTVKURF-UHFFFAOYSA-N |
| SMILES | CCCC1([N+](=O)[O-])CCC(C)(O)C(C(C)=O)C1 |
|
~91%
1-(2-hydroxy-2-... CAS#:7404-75-3 |
| Literature: Ballini, Roberto; Barboni, Luciano; Bosica, Giovanna Journal of Organic Chemistry, 2000 , vol. 65, # 19 p. 6261 - 6263 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Methyl-2-acetyl-4-propyl-4-nitro-cyclohexanol-(1) |
| (+/-)-1-(2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl)-1-ethanone |