1-(2-hydroxy-2,5-dimethyl-5-nitro-cyclohexyl)ethanone
1-(2-hydroxy-2,5-dimethyl-5-nitro-cyclohexyl)ethanone structure
|
Common Name | 1-(2-hydroxy-2,5-dimethyl-5-nitro-cyclohexyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 7404-77-5 | Molecular Weight | 215.24600 | |
| Density | 1.17g/cm3 | Boiling Point | 337.7ºC at 760 mmHg | |
| Molecular Formula | C10H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 337.7ºC at 760 mmHg |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.24600 |
| Flash Point | 142.4ºC |
| Exact Mass | 215.11600 |
| PSA | 83.12000 |
| LogP | 1.68510 |
| Index of Refraction | 1.499 |
| InChIKey | AMVMHQODMGEQGU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1CC(C)([N+](=O)[O-])CCC1(C)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
1-(2-hydroxy-2,... CAS#:7404-77-5 |
| Literature: Gomez-Bengoa, Enrique; Cuerva, Juan M.; Mateo, Cristina; Echavarren, Antonio M. Journal of the American Chemical Society, 1996 , vol. 118, # 36 p. 8553 - 8565 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:2142-73-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(2,5-dimethyl-2-hydroxy-5-nitrocyclohexyl)ethanone |
| 1-(2-hydroxy-2,5-dimethyl-5-nitro-cyclohexyl)-ethanone |
| 1,4-Dimethyl-2-acetyl-4-nitro-cyclohexanol-(1) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 7404-77-5? |
| A: Chinese name of 7404-77-5 is 7404-77-5. |
| Q: What is the polar surface area (PSA) of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone? |
| A: Polar surface area (PSA) of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone is 83.12000. |
| Q: What are the downstream products of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone? |
| A: Related downstream products(CAS) of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone: 2142-73-6. |
| Q: What English synonyms does 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone have? |
| A: English synonyms of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone: 1-(2,5-dimethyl-2-hydroxy-5-nitrocyclohexyl)ethanone, 1-(2-hydroxy-2,5-dimethyl-5-nitro-cyclohexyl)-ethanone, 1,4-Dimethyl-2-acetyl-4-nitro-cyclohexanol-(1). |
| Q: What is the CAS number of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone? |
| A: CAS number of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone is 7404-77-5. |
| Q: What is the molecular weight of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone? |
| A: Molecular weight of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone is 215.24600. |
| Q: What is the LogP of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone? |
| A: LogP of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone is 1.68510. |
| Q: What is the molecular formula of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone? |
| A: Molecular formula of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone is C10H17NO4. |
| Q: What is the English name of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone? |
| A: The English name of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone is 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone. |
| Q: What is the boiling point of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone? |
| A: Boiling point of 1-(2-hydroxy-2,5-dimethyl-5-nitrocyclohexyl)ethanone is 337.7ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |