3-nitro-1-phenyl-butan-1-one structure
|
Common Name | 3-nitro-1-phenyl-butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 7404-78-6 | Molecular Weight | 193.19900 | |
| Density | 1.155g/cm3 | Boiling Point | 331.1ºC at 760 mmHg | |
| Molecular Formula | C10H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157ºC | |
| Name | 3-nitro-1-phenylbutan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 331.1ºC at 760 mmHg |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.19900 |
| Flash Point | 157ºC |
| Exact Mass | 193.07400 |
| PSA | 62.89000 |
| LogP | 2.44780 |
| Index of Refraction | 1.528 |
| InChIKey | ZEMBUDLWKVRNIW-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)c1ccccc1)[N+](=O)[O-] |
|
~32%
3-nitro-1-pheny... CAS#:7404-78-6 |
| Literature: Russell, Glen A.; Kulkarni, Shekhar V.; Khanna, Rajive K. Journal of Organic Chemistry, 1990 , vol. 55, # 3 p. 1080 - 1086 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Nitrobutyrophenone |
| 3-nitro-1-phenyl-butan-1-one |
| 3-Nitro-1-phenyl-1-butanone |