5,9-dinitrotridecane-2,12-dione structure
|
Common Name | 5,9-dinitrotridecane-2,12-dione | ||
|---|---|---|---|---|
| CAS Number | 7404-81-1 | Molecular Weight | 302.32400 | |
| Density | 1.146g/cm3 | Boiling Point | 490.5ºC at 760 mmHg | |
| Molecular Formula | C13H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.8ºC | |
| Name | 5,9-dinitrotridecane-2,12-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 490.5ºC at 760 mmHg |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.32400 |
| Flash Point | 230.8ºC |
| Exact Mass | 302.14800 |
| PSA | 125.78000 |
| LogP | 3.23210 |
| Index of Refraction | 1.475 |
| InChIKey | UFIRUAZYPUGOBZ-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(CCCC(CCC(C)=O)[N+](=O)[O-])[N+](=O)[O-] |
|
~%
5,9-dinitrotrid... CAS#:7404-81-1 |
| Literature: Feuer; Aguilar Journal of Organic Chemistry, 1958 , vol. 23, p. 607 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5,9-dinitro-tridecane-2,12-dione |
| 5,9-Dinitro-tridecan-2,12-dion |