5-ethoxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one structure
|
Common Name | 5-ethoxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one | ||
|---|---|---|---|---|
| CAS Number | 7404-92-4 | Molecular Weight | 442.45800 | |
| Density | 1.34g/cm3 | Boiling Point | 580.9ºC at 760 mmHg | |
| Molecular Formula | C24H26O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.2ºC | |
| Name | 5-ethoxy-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 580.9ºC at 760 mmHg |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.45800 |
| Flash Point | 251.2ºC |
| Exact Mass | 442.16300 |
| PSA | 81.68000 |
| LogP | 3.45340 |
| Index of Refraction | 1.604 |
| InChIKey | STGBBEULPHACPI-UHFFFAOYSA-N |
| SMILES | CCOC1c2cc3c(cc2C(c2cc(OC)c(OC)c(OC)c2)C2C(=O)OCC12)OCO3 |
|
~%
5-ethoxy-9-(3,4... CAS#:7404-92-4 |
| Literature: Hartwell; Schrecker Journal of the American Chemical Society, 1951 , vol. 73, p. 2909,2916 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| epipodophyllotoxin ethyl ether |
| O-ethyl-epipodophyllotoxin |
| Picropodophyllin-1-ethyl ether |
| Furo(3',4':6,7)naphtho(2,3-d)-1,3-dioxol-6(5aH)-one,9-ethoxy-5,8,8a,9-tetrahydro-5-(3,4,5-trimethoxyphenyl)-,(5R-(5alpha,5aalpha,8aalpha,9alpha)) |
| O-Aethyl-epipodophyllotoxin |
| (5R-(5alpha,5aalpha,8aalpha,9alpha))-9-Ethoxy-5,8,8a,9-tetrahydro-5-(3,4,5-trimethoxyphenyl)furo(3',4':6,7)naphtho(2,3-d)-1,3-dioxol-6(5aH)-one |