diethyl 3,4-dihydropyrido[3,4-c]pyridazine-1,2-dicarboxylate structure
|
Common Name | diethyl 3,4-dihydropyrido[3,4-c]pyridazine-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 74057-17-3 | Molecular Weight | 279.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 3,4-dihydropyrido[3,4-c]pyridazine-1,2-dicarboxylate |
|---|
| Molecular Formula | C13H17N3O4 |
|---|---|
| Molecular Weight | 279.29200 |
| Exact Mass | 279.12200 |
| PSA | 71.97000 |
| LogP | 1.97700 |
| InChIKey | SEUMHBLOSRMBPT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCc2ccncc2N1C(=O)OCC |
|
~59%
diethyl 3,4-dih... CAS#:74057-17-3 |
| Literature: Kakulapati, Rama Rao; Nanduri, Bhanumathi; Kota, Narsimha Reddy Bulletin of the Chemical Society of Japan, 1993 , vol. 66, # 8 p. 2429 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |