1-[4-(6-bromohexan-2-yl)phenyl]ethanone structure
|
Common Name | 1-[4-(6-bromohexan-2-yl)phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 74072-50-7 | Molecular Weight | 283.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-(6-bromohexan-2-yl)phenyl]ethanone |
|---|
| Molecular Formula | C14H19BrO |
|---|---|
| Molecular Weight | 283.20400 |
| Exact Mass | 282.06200 |
| PSA | 17.07000 |
| LogP | 4.55790 |
| InChIKey | MAKOLSMIKCSEGQ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(C(C)CCCCBr)cc1 |
|
~%
1-[4-(6-bromohe... CAS#:74072-50-7 |
| Literature: Din, Laily Bin; Meth-Cohn, Otto; Walshe, Nigel D. A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 4 p. 781 - 786 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |