Morpholine,4-[4,5-dihydro-4-methylene-1-(4-nitrophenyl)-1H-1,2,3-triazol-5-yl]- structure
|
Common Name | Morpholine,4-[4,5-dihydro-4-methylene-1-(4-nitrophenyl)-1H-1,2,3-triazol-5-yl]- | ||
|---|---|---|---|---|
| CAS Number | 74073-15-7 | Molecular Weight | 289.29000 | |
| Density | 1.45g/cm3 | Boiling Point | 452.9ºC at 760 mmHg | |
| Molecular Formula | C13H15N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.7ºC | |
| Name | 4-[5-methylidene-3-(4-nitrophenyl)-4H-triazol-4-yl]morpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 452.9ºC at 760 mmHg |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.29000 |
| Flash Point | 227.7ºC |
| Exact Mass | 289.11700 |
| PSA | 86.25000 |
| LogP | 1.35130 |
| Index of Refraction | 1.688 |
| InChIKey | YYNXYVOTRCBQFQ-UHFFFAOYSA-N |
| SMILES | C=C1N=NN(c2ccc([N+](=O)[O-])cc2)C1N1CCOCC1 |
|
~45%
Morpholine,4-[4... CAS#:74073-15-7 |
| Literature: Croce, Piero Dalla; Pocar, Donato; Stradi, Riccardo; Trimarco, Pasqualina Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 141 - 145 |
|
~44%
Morpholine,4-[4... CAS#:74073-15-7 |
| Literature: Croce, Piero Dalla; Pocar, Donato; Stradi, Riccardo; Trimarco, Pasqualina Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 141 - 145 |
|
~%
Morpholine,4-[4... CAS#:74073-15-7 |
| Literature: Croce, Piero Dalla; Pocar, Donato; Stradi, Riccardo; Trimarco, Pasqualina Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 141 - 145 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1H-1,2,3-Triazole,morpholine deriv. |