1,4-bis(4-chlorophenyl)-2-(1-piperidyl)butane-1,4-dione structure
|
Common Name | 1,4-bis(4-chlorophenyl)-2-(1-piperidyl)butane-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 74103-67-6 | Molecular Weight | 390.30300 | |
| Density | 1.263g/cm3 | Boiling Point | 542.1ºC at 760 mmHg | |
| Molecular Formula | C21H21Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.6ºC | |
| Name | 1,4-bis(4-chlorophenyl)-2-piperidin-1-ylbutane-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 542.1ºC at 760 mmHg |
| Molecular Formula | C21H21Cl2NO2 |
| Molecular Weight | 390.30300 |
| Flash Point | 281.6ºC |
| Exact Mass | 389.09500 |
| PSA | 37.38000 |
| LogP | 5.24150 |
| Index of Refraction | 1.594 |
| InChIKey | MHMXHYMUQLTINC-UHFFFAOYSA-N |
| SMILES | O=C(CC(C(=O)c1ccc(Cl)cc1)N1CCCCC1)c1ccc(Cl)cc1 |
|
~%
1,4-bis(4-chlor... CAS#:74103-67-6 |
| Literature: Lutz et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 2224,2226 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,4-Bis-(4-chlor-phenyl)-2-piperidino-butan-1,4-dion |
| 1,4-bis(4-chlorophenyl)-2-(piperidin-1-yl)butane-1,4-dione |
| 1,4-bis-(4-chloro-phenyl)-2-piperidino-butane-1,4-dione |