6-chloro-3-methyl-1-phenyl-7,8-dihydroxy-2,3,4,5-tetrahydro-1H-3-benzazepine structure
|
Common Name | 6-chloro-3-methyl-1-phenyl-7,8-dihydroxy-2,3,4,5-tetrahydro-1H-3-benzazepine | ||
|---|---|---|---|---|
| CAS Number | 74115-04-1 | Molecular Weight | 303.78300 | |
| Density | 1.276g/cm3 | Boiling Point | 452.7ºC at 760mmHg | |
| Molecular Formula | C17H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.6ºC | |
| Name | 6-chloro-3-methyl-1-phenyl-7,8-dihydroxy-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276g/cm3 |
|---|---|
| Boiling Point | 452.7ºC at 760mmHg |
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.78300 |
| Flash Point | 227.6ºC |
| Exact Mass | 303.10300 |
| PSA | 43.70000 |
| LogP | 3.30890 |
| Index of Refraction | 1.627 |
| InChIKey | OZWXDWVFTIFZHS-UHFFFAOYSA-N |
| SMILES | CN1CCc2c(cc(O)c(O)c2Cl)C(c2ccccc2)C1 |
|
~%
6-chloro-3-meth... CAS#:74115-04-1 |
| Literature: Pfeiffer; Wilson; Weinstock; Kuo; Chambers; Holden; Hahn; Wardell Jr.; Tobia; Setler; Sarau Journal of Medicinal Chemistry, 1982 , vol. 25, # 4 p. 352 - 358 |
|
~%
6-chloro-3-meth... CAS#:74115-04-1 |
| Literature: Pfeiffer; Wilson; Weinstock; Kuo; Chambers; Holden; Hahn; Wardell Jr.; Tobia; Setler; Sarau Journal of Medicinal Chemistry, 1982 , vol. 25, # 4 p. 352 - 358 |
|
~%
6-chloro-3-meth... CAS#:74115-04-1 |
| Literature: Pfeiffer; Wilson; Weinstock; Kuo; Chambers; Holden; Hahn; Wardell Jr.; Tobia; Setler; Sarau Journal of Medicinal Chemistry, 1982 , vol. 25, # 4 p. 352 - 358 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3H-Indol-2-amine,6-chloro-3-methyl-3-phenyl-,1-oxide |
| 6-chloro-3-methyl-1-oxy-3-phenyl-3H-indol-2-ylamine |