4-Chloro-3-Nitrophenyl Ethyl Sulfone structure
|
Common Name | 4-Chloro-3-Nitrophenyl Ethyl Sulfone | ||
|---|---|---|---|---|
| CAS Number | 74159-80-1 | Molecular Weight | 249.671 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 419.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H8ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6±28.7 °C | |
| Name | 1-chloro-4-ethylsulfonyl-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.6±45.0 °C at 760 mmHg |
| Molecular Formula | C8H8ClNO4S |
| Molecular Weight | 249.671 |
| Flash Point | 207.6±28.7 °C |
| Exact Mass | 248.986252 |
| PSA | 88.34000 |
| LogP | 1.38 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | VETAODCIKKRRTR-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)c1ccc(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2904909090 |
|---|
|
~64%
4-Chloro-3-Nitr... CAS#:74159-80-1 |
| Literature: Ates-Alagoz, Zeynep; Coleman, Natalia; Martin, Marlena; Wan, Aaron; Adejare, Adeboye Chemical Biology and Drug Design, 2012 , vol. 80, # 6 p. 853 - 861 |
|
~%
4-Chloro-3-Nitr... CAS#:74159-80-1 |
| Literature: Chemical Biology and Drug Design, , vol. 80, # 6 p. 853 - 861 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| ethyl 4-chloro-3-nitrophenyl sulphone |
| 4-Chloro-3-Nitrophenyl Ethyl Sulfone |
| 1-Chloro-4-(ethylsulfonyl)-2-nitrobenzene |
| EINECS 277-737-1 |