1-methanesulfonyl-piperidin-4-ylamine, compound with trifluoro-acetic acid structure
|
Common Name | 1-methanesulfonyl-piperidin-4-ylamine, compound with trifluoro-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 741713-99-5 | Molecular Weight | 292.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H15F3N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methanesulfonyl-piperidin-4-ylamine, compound with trifluoro-acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H15F3N2O4S |
|---|---|
| Molecular Weight | 292.27600 |
| Exact Mass | 292.07000 |
| PSA | 109.08000 |
| LogP | 1.72140 |
| InChIKey | GCVYYLLLHQDSPT-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC(N)CC1.O=C(O)C(F)(F)F |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 1-methanesulfonyl-piperidin-4-ylamine trifluoroacetic acid salt |
| 1-methanesulfonylpiperidin-4-ylamine trifluoroacetate |
| 1-methylsulfonylpiperidin-4-amine TFA salt |