(2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trien-8-ynoic acid structure
|
Common Name | (2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trien-8-ynoic acid | ||
|---|---|---|---|---|
| CAS Number | 74193-14-9 | Molecular Weight | 298.41900 | |
| Density | 1.03g/cm3 | Boiling Point | 436.6ºC at 760 mmHg | |
| Molecular Formula | C20H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
| Name | (2E,4E,6E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6-trien-8-ynoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 436.6ºC at 760 mmHg |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.41900 |
| Flash Point | 207.6ºC |
| Exact Mass | 298.19300 |
| PSA | 37.30000 |
| LogP | 5.04980 |
| Index of Refraction | 1.541 |
| InChIKey | PZGWJKNRUMKVBF-SNQZJYSLSA-N |
| SMILES | CC(C#CC1=C(C)CCCC1(C)C)=CC=CC(C)=CC(=O)O |
|
~%
(2E,4E,6E)-3,7-... CAS#:74193-14-9 |
| Literature: Attenburrow et al. Journal of the Chemical Society, 1952 , p. 1094,1103 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7,8-Dehydroretinoic acid |
| Retinoic acid,7,8-didehydro |
| 7,8-Didehydroretinoic acid |