3-Bromo-1-methyl-4-nitro-1H-indazole structure
|
Common Name | 3-Bromo-1-methyl-4-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 74209-19-1 | Molecular Weight | 256.05600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Bromo-1-methyl-4-nitro-1H-indazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6BrN3O2 |
|---|---|
| Molecular Weight | 256.05600 |
| Exact Mass | 254.96400 |
| PSA | 63.64000 |
| LogP | 2.76720 |
| InChIKey | BZGXALNCZRULPC-UHFFFAOYSA-N |
| SMILES | Cn1nc(Br)c2c([N+](=O)[O-])cccc21 |
| HS Code | 2933990090 |
|---|
|
~%
3-Bromo-1-methy... CAS#:74209-19-1 |
| Literature: Barclay; Campbell; Dodds Journal of the Chemical Society, 1941 , p. 113,117 |
|
~%
3-Bromo-1-methy... CAS#:74209-19-1 |
| Literature: Barclay; Campbell; Dodds Journal of the Chemical Society, 1941 , p. 113,117 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 3-bromo-1-methyl-2-oxocyclopentanecarboxylate |
| 3-Brom-1-methyl-4-nitro-1H-indazol |
| 3-bromo-1-methyl-2-oxo-cyclopentanecarboxylic acid ethyl ester |
| 3-Brom-1-methyl-2-oxo-cyclopentancarbonsaeure-aethylester |
| 5-Brom-2-aethoxycarbonyl-2-methyl-cyclopentan-1-on |