2-(5-methylpyridin-3-yl)-1-phenylethanone structure
|
Common Name | 2-(5-methylpyridin-3-yl)-1-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 74212-41-2 | Molecular Weight | 211.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(5-methylpyridin-3-yl)-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO |
|---|---|
| Molecular Weight | 211.25900 |
| Exact Mass | 211.10000 |
| PSA | 29.96000 |
| LogP | 2.81540 |
| InChIKey | SFLKCYWGQJJTAL-UHFFFAOYSA-N |
| SMILES | Cc1cncc(CC(=O)c2ccccc2)c1 |
|
~%
2-(5-methylpyri... CAS#:74212-41-2 |
| Literature: Baradarani, M. Mehdi; Joule, John A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 72 - 77 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-methyl-3-phenacylpyridine |