N-[bis(dimethylamino)phosphinoselenoyl]-N-methylmethanamine structure
|
Common Name | N-[bis(dimethylamino)phosphinoselenoyl]-N-methylmethanamine | ||
|---|---|---|---|---|
| CAS Number | 7422-73-3 | Molecular Weight | 242.16100 | |
| Density | N/A | Boiling Point | 243.6ºC at 760 mmHg | |
| Molecular Formula | C6H18N3PSe | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.1ºC | |
| Name | N-[bis(dimethylamino)phosphinoselenoyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 243.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C6H18N3PSe |
| Molecular Weight | 242.16100 |
| Flash Point | 101.1ºC |
| Exact Mass | 243.04000 |
| PSA | 19.53000 |
| LogP | 0.51730 |
| InChIKey | DRSNCSQUCDPNCS-UHFFFAOYSA-N |
| SMILES | CN(C)P(=[Se])(N(C)C)N(C)C |
|
~99%
N-[bis(dimethyl... CAS#:7422-73-3 |
| Literature: Konieczny; Gutierrez; Sosnovsky 1983 , vol. 38, # 9 p. 1138 - 1141 |
|
~%
N-[bis(dimethyl... CAS#:7422-73-3 |
| Literature: Krawczyk, Ewa; Skowronnska, Aleksandra; Michalski, Jan Journal of the Chemical Society. Perkin Transactions 2, 2000 , # 6 p. 1135 - 1140 |
|
~%
N-[bis(dimethyl... CAS#:7422-73-3 |
| Literature: Omelanczuk, Jan Tetrahedron, 1993 , vol. 49, # 39 p. 8887 - 8898 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| hexamethylphosphoroselenoic triamide |
| hexamethyl-selenophosphamide |