6-chloro-2,3-dihydroxy-1,4-naphthoquinone
6-chloro-2,3-dihydroxy-1,4-naphthoquinone structure
|
Common Name | 6-chloro-2,3-dihydroxy-1,4-naphthoquinone | ||
|---|---|---|---|---|
| CAS Number | 74237-20-0 | Molecular Weight | 224.59700 | |
| Density | 1.72g/cm3 | Boiling Point | 372.9ºC at 760 mmHg | |
| Molecular Formula | C10H5ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.3ºC | |
Summary: 6-Chloro-1,4-dihydroxynaphthalene-2,3-dione (Chinese name: 6-氯-1,4-二羟基萘-2,3-二酮, CAS number: 74237-20-0, molecular formula: C10H5ClO4, molecular weight: 224.59700), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-chloro-1,4-dihydroxynaphthalene-2,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 372.9ºC at 760 mmHg |
| Molecular Formula | C10H5ClO4 |
| Molecular Weight | 224.59700 |
| Flash Point | 179.3ºC |
| Exact Mass | 223.98800 |
| PSA | 74.60000 |
| Index of Refraction | 1.712 |
| InChIKey | QLHIGRZXEPMGMR-UHFFFAOYSA-N |
| SMILES | O=C1C(O)=C(O)C(=O)c2cc(Cl)ccc21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![6-chloro-2-hydroxy-[1,4]naphthoquinone structure](https://image.chemsrc.com/caspic/391/74237-21-1.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| CDNQ |
| 6-chloro-2,3-dihydroxy-1,4-naphthaquinone |
| 6-chloro-2,3-dihydroxy-1,4-naphthoquinone |
| 2,3-dihydroxy-6-chloro-1,4-naphthoquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione? |
| A: Related upstream materials(CAS) of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione: 102631-97-0;74237-21-1;56961-92-3;106-51-4. |
| Q: What is the CAS number of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione? |
| A: CAS number of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione is 74237-20-0. |
| Q: What English synonyms does 6-chloro-1,4-dihydroxynaphthalene-2,3-dione have? |
| A: English synonyms of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione: CDNQ, 6-chloro-2,3-dihydroxy-1,4-naphthaquinone, 6-chloro-2,3-dihydroxy-1,4-naphthoquinone, 2,3-dihydroxy-6-chloro-1,4-naphthoquinone. |
| Q: What is the polar surface area (PSA) of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione? |
| A: Polar surface area (PSA) of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione is 74.60000. |
| Q: What is the SMILES notation of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione? |
| A: SMILES notation of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione is O=C1C(O)=C(O)C(=O)c2cc(Cl)ccc21. |
| Q: What is the Chinese name of 74237-20-0? |
| A: Chinese name of 74237-20-0 is 74237-20-0. |
| Q: What is the boiling point of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione? |
| A: Boiling point of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione is 372.9ºC at 760 mmHg. |
| Q: What is the English name of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione? |
| A: The English name of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione is 6-chloro-1,4-dihydroxynaphthalene-2,3-dione. |
| Q: What is the molecular formula of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione? |
| A: Molecular formula of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione is C10H5ClO4. |
| Q: What is the InChIKey of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione? |
| A: InChIKey of 6-chloro-1,4-dihydroxynaphthalene-2,3-dione is QLHIGRZXEPMGMR-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |