(2S)-2-amino-4-methylsulfanyl-N-naphthalen-2-ylbutanamide structure
|
Common Name | (2S)-2-amino-4-methylsulfanyl-N-naphthalen-2-ylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 7424-16-0 | Molecular Weight | 274.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-amino-4-methylsulfanyl-N-naphthalen-2-ylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H18N2OS |
|---|---|
| Molecular Weight | 274.38100 |
| Exact Mass | 274.11400 |
| PSA | 80.42000 |
| LogP | 3.63200 |
| InChIKey | CHWHUPKCZKLQIM-AWEZNQCLSA-N |
| SMILES | CSCCC(N)C(=O)Nc1ccc2ccccc2c1 |
|
~%
(2S)-2-amino-4-... CAS#:7424-16-0 |
| Literature: BOARD OF REGENTS, THE UNIVERSITY OF TEXAS SYSTEM; ARMSTRONG, Daniel, W.; PING, Sun; BREITBACH, Zachary, S.; WANG, Chunlei Patent: WO2010/148191 A2, 2010 ; Location in patent: Page/Page column 45-49; 60 ; |
|
~%
(2S)-2-amino-4-... CAS#:7424-16-0 |
| Literature: Goldstein,T.P. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 852 - 857 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Butyramide,2-amino-4-(methylthio)-N-2-naphthyl-,L-(8CI) |
| L-Methionin-<naphthyl-(2)-amid> |
| Butanamide,2-amino-4-(methylthio)-N-2-naphthalenyl-,(S) |
| Methionine b-naphthylamide |
| Met-bNA |
| L-Methionyl b-naphthylamide |
| L-Methionine b-naphthylamide |
| N-L-Methionyl-2-naphthylamin |
| N-L-Methionyl-2-naphthylamine |