Hydrocortisone N,N-dimethylsuccinamate
Modify Date: 2025-09-12 23:08:51
Hydrocortisone N,N-dimethylsuccinamate structure
|
Common Name | Hydrocortisone N,N-dimethylsuccinamate | ||
|---|---|---|---|---|
| CAS Number | 74253-50-2 | Molecular Weight | 489.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H39NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hydrocortisone N,N-dimethylsuccinamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H39NO7 |
|---|---|
| Molecular Weight | 489.6 |
| InChIKey | GTCKMDDVRMAXDO-HGDQABOUSA-N |
| SMILES | CN(C)C(=O)CCC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Hydrocortisone N,N-dimethylsuccinamate? |
| A: SMILES notation of Hydrocortisone N,N-dimethylsuccinamate is CN(C)C(=O)CCC(=O)OCC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3C(O)CC21C. |
| Q: What is the Chinese name of 74253-50-2? |
| A: Chinese name of 74253-50-2 is 74253-50-2. |
| Q: What is the CAS number of Hydrocortisone N,N-dimethylsuccinamate? |
| A: CAS number of Hydrocortisone N,N-dimethylsuccinamate is 74253-50-2. |
| Q: What is the molecular weight of Hydrocortisone N,N-dimethylsuccinamate? |
| A: Molecular weight of Hydrocortisone N,N-dimethylsuccinamate is 489.6. |
| Q: What is the InChIKey of Hydrocortisone N,N-dimethylsuccinamate? |
| A: InChIKey of Hydrocortisone N,N-dimethylsuccinamate is GTCKMDDVRMAXDO-HGDQABOUSA-N. |
| Q: What is the molecular formula of Hydrocortisone N,N-dimethylsuccinamate? |
| A: Molecular formula of Hydrocortisone N,N-dimethylsuccinamate is C27H39NO7. |
| Q: What is the English name of Hydrocortisone N,N-dimethylsuccinamate? |
| A: The English name of Hydrocortisone N,N-dimethylsuccinamate is Hydrocortisone N,N-dimethylsuccinamate. |