12-Oxograndiflorenic acid structure
|
Common Name | 12-Oxograndiflorenic acid | ||
|---|---|---|---|---|
| CAS Number | 74284-42-7 | Molecular Weight | 314.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 12-Oxograndiflorenic acid12-Oxograndiflorenic acid is a natural product that can be isolated from vegetative Ambrosia hispida. Synonyms is ent-12-oxokaura-9(11),16-dien-19-oic acid[1]. |
| Name | 12-Oxograndiflorenic acid |
|---|
| Description | 12-Oxograndiflorenic acid is a natural product that can be isolated from vegetative Ambrosia hispida. Synonyms is ent-12-oxokaura-9(11),16-dien-19-oic acid[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C20H26O3 |
|---|---|
| Molecular Weight | 314.4 |
| InChIKey | ZIWVZWGUPHJFMN-XXEDRWDRSA-N |
| SMILES | C=C1CC23CCC4C(C)(C(=O)O)CCCC4(C)C2=CC(=O)C1C3 |
| Storage condition | 2-8℃ |