magnesium,2-methylpentane,bromide
magnesium,2-methylpentane,bromide structure
|
Common Name | magnesium,2-methylpentane,bromide | ||
|---|---|---|---|---|
| CAS Number | 7429-94-9 | Molecular Weight | 189.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H13BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Magnesium,2-methylpentane,bromide, Chinese name: 镁2-甲基戊烷溴化物, CAS number: 7429-94-9, molecular formula: C6H13BrMg, molecular weight: 189.37600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | magnesium,2-methylpentane,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H13BrMg |
|---|---|
| Molecular Weight | 189.37600 |
| Exact Mass | 188.00500 |
| InChIKey | BZDFGMAKNIPSQZ-UHFFFAOYSA-M |
| SMILES | [Br-].[CH2-]CCC(C)C.[Mg+2] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
magnesium,2-met... CAS#:7429-94-9 |
| Literature: IMPERIAL CHEMICAL INDUSTRIES PLC Patent: EP307115 A1, 1989 ; EP 0307115 A1 |
|
~%
magnesium,2-met... CAS#:7429-94-9 |
| Literature: Boonananwong, Suthinee; Kongkathip, Boonsong; Kongkathip, Ngampong Steroids, 2008 , vol. 73, # 11 p. 1123 - 1127 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 5 | |
CAS#:4730-22-7
CAS#:516-72-3
CAS#:1653-40-3
CAS#:66719-55-9
CAS#:52648-04-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| magnesioisohexyl bromide |
| 4-methylpentyl magnesium bromide |
| isohexylmagnesium bromide |
| 1-magnesium-bromo-4-methyl-pentane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of magnesium,2-methylpentane,bromide? |
| A: Related downstream products(CAS) of magnesium,2-methylpentane,bromide: 4730-22-7;516-72-3;1653-40-3;66719-55-9;52648-04-1. |
| Q: What is the CAS number of magnesium,2-methylpentane,bromide? |
| A: CAS number of magnesium,2-methylpentane,bromide is 7429-94-9. |
| Q: What is the SMILES notation of magnesium,2-methylpentane,bromide? |
| A: SMILES notation of magnesium,2-methylpentane,bromide is [Br-].[CH2-]CCC(C)C.[Mg+2]. |
| Q: What is the InChIKey of magnesium,2-methylpentane,bromide? |
| A: InChIKey of magnesium,2-methylpentane,bromide is BZDFGMAKNIPSQZ-UHFFFAOYSA-M. |
| Q: What is the molecular formula of magnesium,2-methylpentane,bromide? |
| A: Molecular formula of magnesium,2-methylpentane,bromide is C6H13BrMg. |
| Q: What English synonyms does magnesium,2-methylpentane,bromide have? |
| A: English synonyms of magnesium,2-methylpentane,bromide: magnesioisohexyl bromide, 4-methylpentyl magnesium bromide, isohexylmagnesium bromide, 1-magnesium-bromo-4-methyl-pentane. |
| Q: What are the upstream materials of magnesium,2-methylpentane,bromide? |
| A: Related upstream materials(CAS) of magnesium,2-methylpentane,bromide: 6802-75-1;626-88-0. |
| Q: What is the Chinese name of 7429-94-9? |
| A: Chinese name of 7429-94-9 is 7429-94-9. |
| Q: What is the English name of magnesium,2-methylpentane,bromide? |
| A: The English name of magnesium,2-methylpentane,bromide is magnesium,2-methylpentane,bromide. |
| Q: What is the molecular weight of magnesium,2-methylpentane,bromide? |
| A: Molecular weight of magnesium,2-methylpentane,bromide is 189.37600. |