2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid
2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid structure
|
Common Name | 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 74294-76-1 | Molecular Weight | 195.17500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-Acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid, CAS号74294-76-1, molecular formula C8H9N3O3, molecular weight 195.17500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9N3O3 |
|---|---|
| Molecular Weight | 195.17500 |
| Exact Mass | 195.06400 |
| PSA | 98.57000 |
| LogP | 0.81160 |
| InChIKey | MJECYCKZKJWVTH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(=Cc1cnc[nH]1)C(=O)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-acetamido-3-(... CAS#:74294-76-1 |
| Literature: Deulofeu; Mitta Journal of Organic Chemistry, 1949 , vol. 14, p. 915,917 Anales de la Asociacion Quimica Argentina (1921-2001), 1950 , vol. 38, p. 34,39 |
|
~%
2-acetamido-3-(... CAS#:74294-76-1 |
| Literature: Battersby; Nicoletti; Staunton; Vleggaar Journal of the Chemical Society. Perkin transactions 1, 1980 , vol. 1, p. 43 - 51 |
![2-methyl-4-[N-acetylimidazol-4(5)-ylmethylene]-5-oxazolone structure](https://image.chemsrc.com/caspic/374/74294-79-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:2504-83-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: Molecular formula of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid is C8H9N3O3. |
| Q: What are the upstream materials of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: Related upstream materials(CAS) of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid: 3034-50-2;543-24-8;74294-79-4. |
| Q: What are the downstream products of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: Related downstream products(CAS) of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid: 2504-83-8. |
| Q: What is the molecular weight of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: Molecular weight of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid is 195.17500. |
| Q: What is the polar surface area (PSA) of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: Polar surface area (PSA) of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid is 98.57000. |
| Q: What is the InChIKey of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: InChIKey of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid is MJECYCKZKJWVTH-UHFFFAOYSA-N. |
| Q: What is the English name of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: The English name of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid is 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid. |
| Q: What is the LogP of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: LogP of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid is 0.81160. |
| Q: What is the CAS number of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: CAS number of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid is 74294-76-1. |
| Q: What is the SMILES notation of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid? |
| A: SMILES notation of 2-acetamido-3-(1H-imidazol-5-yl)prop-2-enoic acid is CC(=O)NC(=Cc1cnc[nH]1)C(=O)O. |