2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine
Modify Date: 2026-07-04 14:16:25
2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine structure
|
Common Name | 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine | ||
|---|---|---|---|---|
| CAS Number | 74331-60-5 | Molecular Weight | 187.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17N |
|---|---|
| Molecular Weight | 187.28 |
| InChIKey | BWMQYEXGFZKFMW-UHFFFAOYSA-N |
| SMILES | CC(C)=C=Nc1c(C)cc(C)cc1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine? |
| A: SMILES notation of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine is CC(C)=C=Nc1c(C)cc(C)cc1C. |
| Q: What is the InChIKey of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine? |
| A: InChIKey of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine is BWMQYEXGFZKFMW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine? |
| A: Molecular formula of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine is C13H17N. |
| Q: What is the CAS number of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine? |
| A: CAS number of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine is 74331-60-5. |
| Q: What is the molecular weight of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine? |
| A: Molecular weight of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine is 187.28. |
| Q: What is the English name of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine? |
| A: The English name of 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine is 2,4,6-Trimethyl-N-(2-methyl-1-propen-1-ylidene)benzenamine. |
| Q: What is the Chinese name of 74331-60-5? |
| A: Chinese name of 74331-60-5 is 74331-60-5. |