N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide
N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide structure
|
Common Name | N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 74331-99-0 | Molecular Weight | 165.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(3,4-Dioxocyclohexa-1,5-dien-1-yl)acetamide, CAS号74331-99-0, molecular formula C8H7NO3, molecular weight 165.14600, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7NO3 |
|---|---|
| Molecular Weight | 165.14600 |
| Exact Mass | 165.04300 |
| PSA | 66.73000 |
| LogP | 0.55470 |
| InChIKey | ZURSEPSYQSVJFZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=O)C(=O)C=C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(3,4-dioxocyc... CAS#:74331-99-0 |
| Literature: Horner; Duerckheimer Zeitschrift fuer Naturforschung, 1959 , vol. 14b, p. 741 |
|
~%
N-(3,4-dioxocyc... CAS#:74331-99-0 |
| Literature: Kehrmann; Hoehn Helvetica Chimica Acta, 1925 , vol. 8, p. 222 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 4 | |
CAS#:135-67-1
CAS#:258-72-0
CAS#:2876-23-5
CAS#:636-25-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Acetamido-o-benzochinon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide? |
| A: SMILES notation of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide is CC(=O)NC1=CC(=O)C(=O)C=C1. |
| Q: What is the molecular weight of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide? |
| A: Molecular weight of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide is 165.14600. |
| Q: What English synonyms does N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide have? |
| A: English synonyms of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide: 4-Acetamido-o-benzochinon. |
| Q: What is the LogP of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide? |
| A: LogP of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide is 0.55470. |
| Q: What is the CAS number of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide? |
| A: CAS number of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide is 74331-99-0. |
| Q: What is the polar surface area (PSA) of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide? |
| A: Polar surface area (PSA) of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide is 66.73000. |
| Q: What are the downstream products of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide? |
| A: Related downstream products(CAS) of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide: 135-67-1;258-72-0;2876-23-5;636-25-9. |
| Q: What is the Chinese name of 74331-99-0? |
| A: Chinese name of 74331-99-0 is 74331-99-0. |
| Q: What is the molecular formula of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide? |
| A: Molecular formula of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide is C8H7NO3. |
| Q: What are the upstream materials of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide? |
| A: Related upstream materials(CAS) of N-(3,4-dioxocyclohexa-1,5-dien-1-yl)acetamide: 37519-14-5;74332-02-8. |