Benzoicacid,2-[(3-bromophenyl)methoxy]- structure
|
Common Name | Benzoicacid,2-[(3-bromophenyl)methoxy]- | ||
|---|---|---|---|---|
| CAS Number | 743453-43-2 | Molecular Weight | 307.139 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 450.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.9±23.2 °C | |
| Name | 2-((3-Bromobenzyl)oxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 450.0±25.0 °C at 760 mmHg |
| Molecular Formula | C14H11BrO3 |
| Molecular Weight | 307.139 |
| Flash Point | 225.9±23.2 °C |
| Exact Mass | 305.989136 |
| PSA | 46.53000 |
| LogP | 3.92 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | XXEHDADBNHDAIB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1OCc1cccc(Br)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(3-bromophenyl)methoxy]benzoic acid |
| 2-[(3-Bromobenzyl)oxy]benzoic acid |
| Benzoic acid, 2-[(3-bromophenyl)methoxy]- |
| Benzoicacid,2-[(3-bromophenyl)methoxy]- |