ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate
ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate structure
|
Common Name | ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate | ||
|---|---|---|---|---|
| CAS Number | 74367-91-2 | Molecular Weight | 213.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate (Chinese name: 乙基5-氨基-2,2-二乙基-3-戊烯-4-烯酸酯, CAS number: 74367-91-2, molecular formula: C11H19NO3, molecular weight: 213.27300), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H19NO3 |
|---|---|
| Molecular Weight | 213.27300 |
| Exact Mass | 213.13600 |
| PSA | 69.39000 |
| LogP | 2.09770 |
| InChIKey | ZHPWAYULCIWZCQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)(CC)C(=O)C=CN |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 5-amino-2... CAS#:74367-91-2 |
| Literature: Tsukita Yakugaku Zasshi, 1949 , vol. 69, p. 194 Chem.Abstr., 1950 , p. 1507 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:77-03-2
CAS#:77-04-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,2-diethyl-5-amino-3-oxo-pent-4-enoic acid ethyl ester |
| 4-Pentenoic acid,5-amino-2,2-diethyl-3-oxo-,ethyl ester |
| 2,2-Diaethyl-5-amino-3-oxo-pent-4-ensaeure-aethylester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate? |
| A: The English name of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate is ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate. |
| Q: What is the SMILES notation of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate? |
| A: SMILES notation of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate is CCOC(=O)C(CC)(CC)C(=O)C=CN. |
| Q: What are the upstream materials of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate? |
| A: Related upstream materials(CAS) of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate: 1619-57-4;6313-33-3. |
| Q: What is the molecular weight of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate? |
| A: Molecular weight of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate is 213.27300. |
| Q: What is the molecular formula of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate? |
| A: Molecular formula of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate is C11H19NO3. |
| Q: What is the Chinese name of 74367-91-2? |
| A: Chinese name of 74367-91-2 is 74367-91-2. |
| Q: What is the LogP of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate? |
| A: LogP of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate is 2.09770. |
| Q: What is the CAS number of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate? |
| A: CAS number of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate is 74367-91-2. |
| Q: What English synonyms does ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate have? |
| A: English synonyms of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate: 2,2-diethyl-5-amino-3-oxo-pent-4-enoic acid ethyl ester, 4-Pentenoic acid,5-amino-2,2-diethyl-3-oxo-,ethyl ester, 2,2-Diaethyl-5-amino-3-oxo-pent-4-ensaeure-aethylester. |
| Q: What is the polar surface area (PSA) of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate? |
| A: Polar surface area (PSA) of ethyl 5-amino-2,2-diethyl-3-oxopent-4-enoate is 69.39000. |