Benzenamine,N-[(4-methoxyphenyl)methylene]-4-(2-phenyldiazenyl)- structure
|
Common Name | Benzenamine,N-[(4-methoxyphenyl)methylene]-4-(2-phenyldiazenyl)- | ||
|---|---|---|---|---|
| CAS Number | 744-66-1 | Molecular Weight | 315.36800 | |
| Density | 1.09g/cm3 | Boiling Point | 496.8ºC at 760 mmHg | |
| Molecular Formula | C20H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5ºC | |
| Name | 4-[(4-methoxybenzylidene)amino]azobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 496.8ºC at 760 mmHg |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.36800 |
| Flash Point | 203.5ºC |
| Exact Mass | 315.13700 |
| PSA | 46.31000 |
| LogP | 5.86120 |
| Index of Refraction | 1.59 |
| InChIKey | HLJXCFUTNROPTR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2ccc(N=Nc3ccccc3)cc2)cc1 |
|
~%
Benzenamine,N-[... CAS#:744-66-1 |
| Literature: Pope; Willett Journal of the Chemical Society, 1913 , vol. 103, p. 1260 |
|
~%
Benzenamine,N-[... CAS#:744-66-1 |
| Literature: Vorlaender; Schuster Journal fuer Praktische Chemie (Leipzig), 1934 , vol. <2>140, p. 193,207 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Anisal-p-aminoazobenzene |
| P-METHOXYBENZYLIDENE P-PHENYLAZOANILINE |
| 4-n-methoxybenzylidene-4'-phenylazoaniline |
| 4-Benzolazo-N-anisal-anilin |
| 4'-METHOXYBENZYLIDENEAMINOAZOBENZENE |
| 4-Anisalaminoazobenzene |