ethyl perfluoro(3-methyl-2-oxobutyrate)
Modify Date: 2026-07-16 17:59:12
ethyl perfluoro(3-methyl-2-oxobutyrate) structure
|
Common Name | ethyl perfluoro(3-methyl-2-oxobutyrate) | ||
|---|---|---|---|---|
| CAS Number | 74405-85-9 | Molecular Weight | 270.10200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H5F7O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl perfluoro(3-methyl-2-oxobutyrate) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H5F7O3 |
|---|---|
| Molecular Weight | 270.10200 |
| Exact Mass | 270.01300 |
| PSA | 43.37000 |
| LogP | 1.95150 |
| InChIKey | RLXXVOHIWNLLHP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C(F)(C(F)(F)F)C(F)(F)F |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 4 | |
CAS#:471-46-5
CAS#:620-81-5
CAS#:1457-85-8
CAS#:1526-49-4This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 74405-85-9? |
| A: Chinese name of 74405-85-9 is 74405-85-9. |
| Q: What is the English name of ethyl perfluoro(3-methyl-2-oxobutyrate)? |
| A: The English name of ethyl perfluoro(3-methyl-2-oxobutyrate) is ethyl perfluoro(3-methyl-2-oxobutyrate). |
| Q: What is the molecular weight of ethyl perfluoro(3-methyl-2-oxobutyrate)? |
| A: Molecular weight of ethyl perfluoro(3-methyl-2-oxobutyrate) is 270.10200. |
| Q: What is the SMILES notation of ethyl perfluoro(3-methyl-2-oxobutyrate)? |
| A: SMILES notation of ethyl perfluoro(3-methyl-2-oxobutyrate) is CCOC(=O)C(=O)C(F)(C(F)(F)F)C(F)(F)F. |
| Q: What is the CAS number of ethyl perfluoro(3-methyl-2-oxobutyrate)? |
| A: CAS number of ethyl perfluoro(3-methyl-2-oxobutyrate) is 74405-85-9. |
| Q: What is the InChIKey of ethyl perfluoro(3-methyl-2-oxobutyrate)? |
| A: InChIKey of ethyl perfluoro(3-methyl-2-oxobutyrate) is RLXXVOHIWNLLHP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of ethyl perfluoro(3-methyl-2-oxobutyrate)? |
| A: Polar surface area (PSA) of ethyl perfluoro(3-methyl-2-oxobutyrate) is 43.37000. |
| Q: What is the LogP of ethyl perfluoro(3-methyl-2-oxobutyrate)? |
| A: LogP of ethyl perfluoro(3-methyl-2-oxobutyrate) is 1.95150. |
| Q: What is the molecular formula of ethyl perfluoro(3-methyl-2-oxobutyrate)? |
| A: Molecular formula of ethyl perfluoro(3-methyl-2-oxobutyrate) is C7H5F7O3. |
| Q: What are the downstream products of ethyl perfluoro(3-methyl-2-oxobutyrate)? |
| A: Related downstream products(CAS) of ethyl perfluoro(3-methyl-2-oxobutyrate): 471-46-5;620-81-5;1457-85-8;1526-49-4. |