2-amino-3,3-bis(4-dimethylaminophenyl)isoindol-1-one structure
|
Common Name | 2-amino-3,3-bis(4-dimethylaminophenyl)isoindol-1-one | ||
|---|---|---|---|---|
| CAS Number | 74415-33-1 | Molecular Weight | 386.48900 | |
| Density | 1.221g/cm3 | Boiling Point | 557.3ºC at 760 mmHg | |
| Molecular Formula | C24H26N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.8ºC | |
| Name | 2-amino-3,3-bis[4-(dimethylamino)phenyl]isoindol-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 557.3ºC at 760 mmHg |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.48900 |
| Flash Point | 290.8ºC |
| Exact Mass | 386.21100 |
| PSA | 52.81000 |
| LogP | 4.07820 |
| Index of Refraction | 1.672 |
| InChIKey | KGQQDECHVUTVPS-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C2(c3ccc(N(C)C)cc3)c3ccccc3C(=O)N2N)cc1 |
|
~%
2-amino-3,3-bis... CAS#:74415-33-1 |
| Literature: Kuzuya; Usui; Ito; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 12 p. 3561 - 3569 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,3-bis-(p-dimethylaminophenyl)-N-aminophthalimidine |
| 2-amino-3,3-bis(4-dimethylaminophenyl)isoindol-1-one |
| 3,3-bis(p-dimethylaminophenyl)-N-aminophtalimine |