1,2-bis(3,4-dichlorophenyl)ethane-1,2-dione structure
|
Common Name | 1,2-bis(3,4-dichlorophenyl)ethane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 74417-18-8 | Molecular Weight | 348.00800 | |
| Density | 1.525g/cm3 | Boiling Point | 488.3ºC at 760 mmHg | |
| Molecular Formula | C14H6Cl4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.8ºC | |
| Name | 1,2-bis(3,4-dichlorophenyl)ethane-1,2-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.525g/cm3 |
|---|---|
| Boiling Point | 488.3ºC at 760 mmHg |
| Molecular Formula | C14H6Cl4O2 |
| Molecular Weight | 348.00800 |
| Flash Point | 204.8ºC |
| Exact Mass | 345.91200 |
| PSA | 34.14000 |
| LogP | 5.36580 |
| Index of Refraction | 1.626 |
| InChIKey | BNPXXVPZEQCQGM-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2914700090 |
|---|
|
~30%
1,2-bis(3,4-dic... CAS#:74417-18-8 |
| Literature: Hoechst Aktiengesellschaft Patent: US5463135 A1, 1995 ; |
|
~%
1,2-bis(3,4-dic... CAS#:74417-18-8 |
| Literature: Lin, Yang; Lei, Xiaoli; Yang, Qin; Yuan, Jiangjun; Ding, Qiuping; Xu, Jingshi; Peng, Yiyuan Synthesis (Germany), 2012 , vol. 44, # 17 p. 2699 - 2706 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,3',4,4'-tetrachlorobenzil |
| 3,4,3',4',5'-Pentachlorobiphenyl |
| 3,4,5,3',4'-Penta coplanar polychlorinated biphenyl |
| 33'44'5-pentachlorinated biphenyl |
| 3,3',4,4',5-Pentachloro-1,1'-biphenyl |
| 3,4,5,3',4'-Pentachloro-biphenyl |
| 3,3',4,4',5-Pentachlorobiphenyl |