2,3-bis(benzylsulfanyl)naphthalene-1,4-dione structure
|
Common Name | 2,3-bis(benzylsulfanyl)naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 74417-30-4 | Molecular Weight | 402.52900 | |
| Density | 1.32g/cm3 | Boiling Point | 553.1ºC at 760 mmHg | |
| Molecular Formula | C24H18O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231ºC | |
| Name | 2,3-bis(benzylsulfanyl)naphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 553.1ºC at 760 mmHg |
| Molecular Formula | C24H18O2S2 |
| Molecular Weight | 402.52900 |
| Flash Point | 231ºC |
| Exact Mass | 402.07500 |
| PSA | 84.74000 |
| LogP | 6.14400 |
| Index of Refraction | 1.703 |
| InChIKey | HBUPFHHWQGUXOM-UHFFFAOYSA-N |
| SMILES | O=C1C(SCc2ccccc2)=C(SCc2ccccc2)C(=O)c2ccccc21 |
|
~%
2,3-bis(benzyls... CAS#:74417-30-4 |
| Literature: Tjepkema Recueil des Travaux Chimiques des Pays-Bas, 1952 , vol. 71, p. 853,855,856 |
|
~%
2,3-bis(benzyls... CAS#:74417-30-4 |
| Literature: Shah, J. N.; Tilak, B. D. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 1 p. 29 - 36 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,3-di(benzylthio)-1,4-dihydronaphthalene-1,4-dione |
| 2,3-dibenzylmercapto-1,4-naphthoquinone |
| 2,3-bis-benzylsulfanyl-[1,4]naphthoquinone |
| 2,3-Bis-benzylmercapto-[1,4]naphthochinon |