tert-Butyl 4-(1H-indazol-6-yl)piperazine-1-carboxylate structure
|
Common Name | tert-Butyl 4-(1H-indazol-6-yl)piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 744219-43-0 | Molecular Weight | 302.37100 | |
| Density | 1.231 | Boiling Point | 482.9ºC at 760 mmHg | |
| Molecular Formula | C16H22N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-Butyl 4-(1H-indazol-6-yl)piperazine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231 |
|---|---|
| Boiling Point | 482.9ºC at 760 mmHg |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.37100 |
| Exact Mass | 302.17400 |
| PSA | 61.46000 |
| LogP | 2.62290 |
| Index of Refraction | 1.61 |
| InChIKey | HYKLCBVCBVKEDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3cn[nH]c3c2)CC1 |
| HS Code | 2933990090 |
|---|
|
~66%
tert-Butyl 4-(1... CAS#:744219-43-0 |
| Literature: MEMORY PHARMACEUTICALS CORPORATION Patent: US2008/200471 A1, 2008 ; Location in patent: Page/Page column 34; 36 ; US 20080200471 A1 |
|
~35%
tert-Butyl 4-(1... CAS#:744219-43-0 |
| Literature: Wyeth Patent: US2004/167122 A1, 2004 ; Location in patent: Page/Page column 22-23 ; US 20040167122 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(1H-indazol-6-yl)-1-piperazinecarboxylic acid tert-butyl ester |
| 6-(4-BOC-PIPERAZIN-1-YL)-1H-INDAZOLE |
| 6-[4-(t-butoxycarbonyl)piperazin-1-yl]-1H-indazole |