4H-Dibenzo[de,g]quinoline-2,11-diol, 6-[[bis(2-chloroethyl)amino]acetyl]-5,6,6a, 7-tetrahydro-10-methoxy-, 11-acetate structure
|
Common Name | 4H-Dibenzo[de,g]quinoline-2,11-diol, 6-[[bis(2-chloroethyl)amino]acetyl]-5,6,6a, 7-tetrahydro-10-methoxy-, 11-acetate | ||
|---|---|---|---|---|
| CAS Number | 74427-02-4 | Molecular Weight | 507.40600 | |
| Density | 1.348g/cm3 | Boiling Point | 637.5ºC at 760 mmHg | |
| Molecular Formula | C25H28Cl2N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.4ºC | |
| Name | [6-[2-[bis(2-chloroethyl)amino]acetyl]-2-hydroxy-10-methoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-11-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 637.5ºC at 760 mmHg |
| Molecular Formula | C25H28Cl2N2O5 |
| Molecular Weight | 507.40600 |
| Flash Point | 339.4ºC |
| Exact Mass | 506.13800 |
| PSA | 79.31000 |
| LogP | 3.69250 |
| Index of Refraction | 1.61 |
| InChIKey | XFGMGBXXJINQHS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1OC(C)=O)-c1cc(O)cc3c1C(C2)N(C(=O)CN(CCCl)CCCl)CC3 |
|
~49%
4H-Dibenzo[de,g... CAS#:74427-02-4 |
| Literature: Neumeyer, John L.; Granchelli, Felix E.; Filer, Crist N.; Soloway, Albert H.; Law, Say-Jong Journal of Medicinal Chemistry, 1980 , vol. 23, # 9 p. 1008 - 1013 |
|
~%
4H-Dibenzo[de,g... CAS#:74427-02-4 |
| Literature: Neumeyer, John L.; Granchelli, Felix E.; Filer, Crist N.; Soloway, Albert H.; Law, Say-Jong Journal of Medicinal Chemistry, 1980 , vol. 23, # 9 p. 1008 - 1013 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4H-Dibenzo[de,11-diol,6-[[bis(2-chloroethyl)amino]acetyl]-5,6,6a,7-tetrahydro-10-methoxy-,11-acetate |
| 11-acetoxy-6-[2-(bis(2-chloroethyl)amino)acetyl]-2-hydroxy-10-methoxyaporphine |