Amoxicillin clavulanate potassium structure
|
Common Name | Amoxicillin clavulanate potassium | ||
|---|---|---|---|---|
| CAS Number | 74469-00-4 | Molecular Weight | 602.655 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H27KN4O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Amoxicillin clavulanate potassiumAmoxicillin-clavulanate potassium is an antibiotic. Amoxicillin-clavulanate potassium has the potential for the research of various bacterial infection[1]. |
| Name | Potassium (3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (2S,5R,6R)-6-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (1:1:1) |
|---|---|
| Synonym | More Synonyms |
| Description | Amoxicillin-clavulanate potassium is an antibiotic. Amoxicillin-clavulanate potassium has the potential for the research of various bacterial infection[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Evans J, Hannoodee M, Wittler M. Amoxicillin Clavulanate. [Updated 2021 Dec 15]. |
| Molecular Formula | C24H27KN4O10S |
|---|---|
| Molecular Weight | 602.655 |
| Exact Mass | 602.108521 |
| InChIKey | DWHGNUUWCJZQHO-ZVDZYBSKSA-M |
| SMILES | CC1(C)SC2C(NC(=O)C(N)c3ccc(O)cc3)C(=O)N2C1C(=O)O.O=C([O-])C1C(=CCO)OC2CC(=O)N21.[K+] |
| Potassium (3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate - (2S,5R,6R)-6-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (1:1:1) |
| Potassium (3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (2S,5R,6R)-6-{[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (1:1:1) |