TR-Peg7-OH
Modify Date: 2026-07-04 05:26:13
TR-Peg7-OH structure
|
Common Name | TR-Peg7-OH | ||
|---|---|---|---|---|
| CAS Number | 745048-17-3 | Molecular Weight | 568.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H44O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | TR-Peg7-OH |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C33H44O8 |
|---|---|
| Molecular Weight | 568.7 |
| InChIKey | RYNGCFKRTLHVGN-UHFFFAOYSA-N |
| SMILES | OCCOCCOCCOCCOCCOCCOCCOC(c1ccccc1)(c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of TR-Peg7-OH? |
| A: InChIKey of TR-Peg7-OH is RYNGCFKRTLHVGN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of TR-Peg7-OH? |
| A: Molecular weight of TR-Peg7-OH is 568.7. |
| Q: What is the English name of TR-Peg7-OH? |
| A: The English name of TR-Peg7-OH is TR-Peg7-OH. |
| Q: What is the molecular formula of TR-Peg7-OH? |
| A: Molecular formula of TR-Peg7-OH is C33H44O8. |
| Q: What is the Chinese name of 745048-17-3? |
| A: Chinese name of 745048-17-3 is 745048-17-3. |
| Q: What is the CAS number of TR-Peg7-OH? |
| A: CAS number of TR-Peg7-OH is 745048-17-3. |
| Q: What is the SMILES notation of TR-Peg7-OH? |
| A: SMILES notation of TR-Peg7-OH is OCCOCCOCCOCCOCCOCCOCCOC(c1ccccc1)(c1ccccc1)c1ccccc1. |