4-benzylsulfonyl-4-methyl-pentan-2-one structure
|
Common Name | 4-benzylsulfonyl-4-methyl-pentan-2-one | ||
|---|---|---|---|---|
| CAS Number | 74508-94-4 | Molecular Weight | 254.34500 | |
| Density | 1.14g/cm3 | Boiling Point | 437.7ºC at 760 mmHg | |
| Molecular Formula | C13H18O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.8ºC | |
| Name | 4-benzylsulfonyl-4-methylpentan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 437.7ºC at 760 mmHg |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.34500 |
| Flash Point | 267.8ºC |
| Exact Mass | 254.09800 |
| PSA | 59.59000 |
| LogP | 3.43990 |
| Index of Refraction | 1.522 |
| InChIKey | FOFSKSFSMKSUHI-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)(C)S(=O)(=O)Cc1ccccc1 |
|
~%
4-benzylsulfony... CAS#:74508-94-4 |
| Literature: Barrett, Anthony G.M.; Barton, Derek H.R.; Nagubandi, Sreemulu Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 237 - 239 |
|
~%
4-benzylsulfony... CAS#:74508-94-4 |
| Literature: Barrett, Anthony G.M.; Barton, Derek H.R.; Nagubandi, Sreemulu Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 237 - 239 |
|
~94%
4-benzylsulfony... CAS#:74508-94-4 |
| Literature: Barrett, Anthony G.M.; Barton, Derek H.R.; Nagubandi, Sreemulu Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 237 - 239 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(benzylsulfonyl)-4-methyl-2-pentanone |
| 4-methyl-4-phenylmethanesulfonyl-pentan-2-one |
| 4-methyl-4-benzylsulphonylpentan-2-one |
| 4-Methyl-4-phenylmethansulfonyl-pentan-2-on |