4-bromo-N-(4-methoxyphenyl)benzenesulfonamide structure
|
Common Name | 4-bromo-N-(4-methoxyphenyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7454-72-0 | Molecular Weight | 342.20800 | |
| Density | 1.564g/cm3 | Boiling Point | 454.6ºC at 760 mmHg | |
| Molecular Formula | C13H12BrNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.7ºC | |
| Name | 4-bromo-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.564g/cm3 |
|---|---|
| Boiling Point | 454.6ºC at 760 mmHg |
| Molecular Formula | C13H12BrNO3S |
| Molecular Weight | 342.20800 |
| Flash Point | 228.7ºC |
| Exact Mass | 340.97200 |
| PSA | 63.78000 |
| LogP | 4.41230 |
| Index of Refraction | 1.631 |
| InChIKey | RQCJPHFHAJZWBS-UHFFFAOYSA-N |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(Br)cc2)cc1 |
|
~%
4-bromo-N-(4-me... CAS#:7454-72-0 |
| Literature: Marvel; Smith Journal of the American Chemical Society, 1923 , vol. 45, p. 2697 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Bromo-p-benzenesulfonanisidide |
| 4-bromo-benzenesulfonic acid p-anisidide |
| 4-Brom-benzolsulfonsaeure-p-anisidid |
| p-Benzenesulfonanisidide,4-bromo |
| 4-methoxy-N-brosylaniline |