bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane
![bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane Structure](https://image.chemsrc.com/caspic/277/74546-79-5.png)
bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane structure
|
Common Name | bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 74546-79-5 | Molecular Weight | 397.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11Cl2N2O2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: bis[(6-Chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane (CAS: 74546-79-5), molecular formula: C16H11Cl2N2O2PS, molecular weight: 397.21600, For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H11Cl2N2O2PS |
|---|---|
| Molecular Weight | 397.21600 |
| Exact Mass | 395.96600 |
| PSA | 86.14000 |
| LogP | 5.52680 |
| InChIKey | ROUHPXPXRNLNTP-UHFFFAOYSA-N |
| SMILES | S=P(Oc1cccc(Cl)n1)(Oc1cccc(Cl)n1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
bis[(6-chloropy... CAS#:74546-79-5 |
| Literature: Purnanand; Danikhel, R. K. Synthesis, 1983 , # 9 p. 731 - 733 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane? |
| A: Molecular formula of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane is C16H11Cl2N2O2PS. |
| Q: What is the InChIKey of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane? |
| A: InChIKey of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane is ROUHPXPXRNLNTP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 74546-79-5? |
| A: Chinese name of 74546-79-5 is 74546-79-5. |
| Q: What is the English name of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane? |
| A: The English name of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane is bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane. |
| Q: What is the polar surface area (PSA) of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane? |
| A: Polar surface area (PSA) of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane is 86.14000. |
| Q: What is the SMILES notation of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane? |
| A: SMILES notation of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane is S=P(Oc1cccc(Cl)n1)(Oc1cccc(Cl)n1)c1ccccc1. |
| Q: What is the LogP of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane? |
| A: LogP of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane is 5.52680. |
| Q: What is the molecular weight of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane? |
| A: Molecular weight of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane is 397.21600. |
| Q: What are the upstream materials of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane? |
| A: Related upstream materials(CAS) of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane: 16879-02-0;3497-00-5. |
| Q: What is the CAS number of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane? |
| A: CAS number of bis[(6-chloropyridin-2-yl)oxy]-phenyl-sulfanylidene-λ5-phosphane is 74546-79-5. |