1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea structure
|
Common Name | 1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 74548-44-0 | Molecular Weight | 252.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea |
|---|
| Molecular Formula | C13H20N2OS |
|---|---|
| Molecular Weight | 252.37600 |
| Exact Mass | 252.13000 |
| PSA | 83.42000 |
| LogP | 2.64230 |
| InChIKey | VZEBRHAMLAZEPA-UHFFFAOYSA-N |
| SMILES | CC(C)C(NC(=S)NCCO)c1ccccc1 |
|
~71%
1-(2-hydroxyeth... CAS#:74548-44-0 |
| Literature: Reiter; Toldy; Schafer; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 1 p. 41 - 53 |
|
~87%
1-(2-hydroxyeth... CAS#:74548-44-0 |
| Literature: Reiter; Toldy; Schafer; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 1 p. 41 - 53 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |