1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea
1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea structure
|
Common Name | 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 74548-46-2 | Molecular Weight | 280.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H24N2OS |
|---|---|
| Molecular Weight | 280.42900 |
| Exact Mass | 280.16100 |
| PSA | 74.63000 |
| LogP | 2.98370 |
| InChIKey | GVRIJFIUPKPYET-UHFFFAOYSA-N |
| SMILES | CCN(CCO)C(=S)NC(c1ccccc1)C(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~52%
1-ethyl-1-(2-hy... CAS#:74548-46-2 |
| Literature: Reiter; Toldy; Schafer; et al. European Journal of Medicinal Chemistry, 1980 , vol. 15, # 1 p. 41 - 53 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea? |
| A: Molecular weight of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea is 280.42900. |
| Q: What is the Chinese name of 74548-46-2? |
| A: Chinese name of 74548-46-2 is 74548-46-2. |
| Q: What is the molecular formula of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea? |
| A: Molecular formula of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea is C15H24N2OS. |
| Q: What is the English name of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea? |
| A: The English name of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea is 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea. |
| Q: What is the LogP of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea? |
| A: LogP of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea is 2.98370. |
| Q: What is the CAS number of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea? |
| A: CAS number of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea is 74548-46-2. |
| Q: What is the polar surface area (PSA) of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea? |
| A: Polar surface area (PSA) of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea is 74.63000. |
| Q: What are the upstream materials of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea? |
| A: Related upstream materials(CAS) of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea: 74788-58-2;110-73-6. |
| Q: What is the InChIKey of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea? |
| A: InChIKey of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea is GVRIJFIUPKPYET-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea? |
| A: SMILES notation of 1-ethyl-1-(2-hydroxyethyl)-3-(2-methyl-1-phenylpropyl)thiourea is CCN(CCO)C(=S)NC(c1ccccc1)C(C)C. |