4,4',6,6'-Tetranitrodiphenic acid, dimethyl ester structure
|
Common Name | 4,4',6,6'-Tetranitrodiphenic acid, dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 74590-04-8 | Molecular Weight | 450.27000 | |
| Density | 1.62g/cm3 | Boiling Point | 627ºC at 760 mmHg | |
| Molecular Formula | C16H10N4O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.6ºC | |
| Name | methyl 2-(2-methoxycarbonyl-4,6-dinitrophenyl)-3,5-dinitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 627ºC at 760 mmHg |
| Molecular Formula | C16H10N4O12 |
| Molecular Weight | 450.27000 |
| Flash Point | 264.6ºC |
| Exact Mass | 450.03000 |
| PSA | 235.88000 |
| LogP | 4.65240 |
| Index of Refraction | 1.643 |
| InChIKey | DAKJWQDVVRIVKB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-c1c(C(=O)OC)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| 4,6,4',6'-tetranitro-diphenic acid dimethyl ester |
| 4,6,4',6'-Tetranitro-diphensaeure-dimethylester |
| Dimethyl ester of 2,4,4',6'-tetranitrobiphenyl-2',6-dicarboxylic acid |
| 4,4',6,6'-tetranitro-2,2'-dicarboxybiphenyl dimethyl ester |