2-chloro-N,6-dimethyl-5-nitro-N-phenyl-pyrimidin-4-amine structure
|
Common Name | 2-chloro-N,6-dimethyl-5-nitro-N-phenyl-pyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 7460-27-7 | Molecular Weight | 278.69400 | |
| Density | 1.389g/cm3 | Boiling Point | 464.8ºC at 760 mmHg | |
| Molecular Formula | C12H11ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.9ºC | |
| Name | Propanedinitrile,[(2-chloro-5-nitrophenyl)methylene] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 464.8ºC at 760 mmHg |
| Molecular Formula | C12H11ClN4O2 |
| Molecular Weight | 278.69400 |
| Flash Point | 234.9ºC |
| Exact Mass | 278.05700 |
| PSA | 74.84000 |
| LogP | 3.63770 |
| Index of Refraction | 1.645 |
| InChIKey | JDGQVAOYUNHCNU-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)nc(N(C)c2ccccc2)c1[N+](=O)[O-] |
|
~%
2-chloro-N,6-di... CAS#:7460-27-7 |
| Literature: Marshall; Walker Journal of the Chemical Society, 1951 , p. 1004,1015 Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, vol. 24, p. 84 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2-chloro-6-methyl-5-nitro-pyrimidin-4-yl)-methyl-phenyl-amine |
| <2-Chlor-5-nitro-benzyliden>-malonsaeure-dinitril |
| 2-Chlor-5-nitro-benzalmalonitril |
| (2-chloro-5-nitro-benzylidene)-malononitrile |
| (2-Chlor-5-nitro-benzyliden)-malononitril |
| (2-Chlor-6-methyl-5-nitro-pyrimidin-4-yl)-methyl-phenyl-amin |