Enoxamast structure
|
Common Name | Enoxamast | ||
|---|---|---|---|---|
| CAS Number | 74604-76-5 | Molecular Weight | 306.29400 | |
| Density | 1.578g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.578g/cm3 |
|---|---|
| Molecular Formula | C13H10N2O5S |
| Molecular Weight | 306.29400 |
| Exact Mass | 306.03100 |
| PSA | 125.99000 |
| LogP | 1.67740 |
| Index of Refraction | 1.687 |
| InChIKey | VKPNJGFKWYNJJG-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)Nc1nc(-c2ccc3c(c2)OCCO3)cs1 |
|
~%
Enoxamast CAS#:74604-76-5 |
| Literature: Hargrave, Karl D.; Hess, Friedrich K.; Oliver, James T. Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1158 - 1163 |
|
~%
Enoxamast CAS#:74604-76-5 |
| Literature: Hargrave, Karl D.; Hess, Friedrich K.; Oliver, James T. Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1158 - 1163 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| F2119-0004 |
| Enoxamast |
| Enoxamast [INN] |
| HMS2953G05 |