6-methoxy-4-[2-(2-nitrophenyl)ethenyl]quinoline structure
|
Common Name | 6-methoxy-4-[2-(2-nitrophenyl)ethenyl]quinoline | ||
|---|---|---|---|---|
| CAS Number | 7461-67-8 | Molecular Weight | 306.31500 | |
| Density | 1.298g/cm3 | Boiling Point | 504.8ºC at 760 mmHg | |
| Molecular Formula | C18H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.1ºC | |
| Name | 6-methoxy-4-[(Z)-2-(2-nitrophenyl)ethenyl]quinoline |
|---|
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 504.8ºC at 760 mmHg |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.31500 |
| Flash Point | 259.1ºC |
| Exact Mass | 306.10000 |
| PSA | 67.94000 |
| LogP | 4.84520 |
| Index of Refraction | 1.716 |
| InChIKey | ARXGPISEAPDMKQ-SREVYHEPSA-N |
| SMILES | COc1ccc2nccc(C=Cc3ccccc3[N+](=O)[O-])c2c1 |
|
~%
6-methoxy-4-[2-... CAS#:7461-67-8 |
| Literature: Tipson; Walton Journal of the American Chemical Society, 1948 , vol. 70, p. 892,894 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |