Benzenepropanol,2,3-dimethoxy-, 1-(N-phenylcarbamate)
Benzenepropanol,2,3-dimethoxy-, 1-(N-phenylcarbamate) structure
|
Common Name | Benzenepropanol,2,3-dimethoxy-, 1-(N-phenylcarbamate) | ||
|---|---|---|---|---|
| CAS Number | 7461-68-9 | Molecular Weight | 315.36400 | |
| Density | 1.165g/cm3 | Boiling Point | 415ºC at 760mmHg | |
| Molecular Formula | C18H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 415ºC at 760mmHg |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.36400 |
| Flash Point | 204.8ºC |
| Exact Mass | 315.14700 |
| PSA | 56.79000 |
| LogP | 3.95810 |
| Index of Refraction | 1.574 |
| InChIKey | QNWODVLGOHFVNV-UHFFFAOYSA-N |
| SMILES | COc1cccc(CCCOC(=O)Nc2ccccc2)c1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Benzenepropanol... CAS#:7461-68-9 |
| Literature: Mason Journal of the American Chemical Society, 1947 , vol. 69, p. 2241 |
|
~%
Benzenepropanol... CAS#:7461-68-9 |
| Literature: Mason Journal of the American Chemical Society, 1947 , vol. 69, p. 2241 |
|
~%
Benzenepropanol... CAS#:7461-68-9 |
| Literature: Mason Journal of the American Chemical Society, 1947 , vol. 69, p. 2241 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate? |
| A: SMILES notation of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate is COc1cccc(CCCOC(=O)Nc2ccccc2)c1OC. |
| Q: What are the upstream materials of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate? |
| A: Related upstream materials(CAS) of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate: 79618-90-9;86-51-1;103853-10-7;103-71-9. |
| Q: What is the English name of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate? |
| A: The English name of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate is 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate. |
| Q: What is the boiling point of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate? |
| A: Boiling point of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate is 415ºC at 760mmHg. |
| Q: What is the LogP of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate? |
| A: LogP of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate is 3.95810. |
| Q: What is the polar surface area (PSA) of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate? |
| A: Polar surface area (PSA) of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate is 56.79000. |
| Q: What is the Chinese name of 7461-68-9? |
| A: Chinese name of 7461-68-9 is 7461-68-9. |
| Q: What is the InChIKey of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate? |
| A: InChIKey of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate is QNWODVLGOHFVNV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate? |
| A: CAS number of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate is 7461-68-9. |
| Q: What is the molecular formula of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate? |
| A: Molecular formula of 3-(2,3-dimethoxyphenyl)propyl N-phenylcarbamate is C18H21NO4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |