2,2-diphenyl-5-tert-butyl-benzo[1,3]dioxole structure
|
Common Name | 2,2-diphenyl-5-tert-butyl-benzo[1,3]dioxole | ||
|---|---|---|---|---|
| CAS Number | 7461-73-6 | Molecular Weight | 330.42000 | |
| Density | 1.123g/cm3 | Boiling Point | 438.7ºC at 760 mmHg | |
| Molecular Formula | C23H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | 5-tert-butyl-2,2-diphenyl-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 438.7ºC at 760 mmHg |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.42000 |
| Flash Point | 220.3ºC |
| Exact Mass | 330.16200 |
| PSA | 18.46000 |
| LogP | 5.65660 |
| Index of Refraction | 1.592 |
| InChIKey | FKNSZGAWVFXWIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc2c(c1)OC(c1ccccc1)(c1ccccc1)O2 |
|
~%
2,2-diphenyl-5-... CAS#:7461-73-6 |
| Literature: Mason Journal of the American Chemical Society, 1944 , vol. 66, p. 1156,1157 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-tert-butyl-2,2-diphenyl-benzo[1,3]dioxole |